Details for Bulk Pharmaceuticals and Intermediates

Bulk Pharmaceuticals and Intermediates
| Category: |
Organic chemicals and Derivatives/Aldehyde and ketone compounds |
|
| CAS NO: |
1458-98-6 |
| EC NO: |
251-723-5 |
| Molecular Formula: |
C4H7Br |
| Molecular Weight: |
135.0024 |
| Specification: |
|
| InChI: |
InChI=1/C4H7Br/c1-4(2)3-5/h1,3H2,2H3 |
| Synonyms: |
3-Bromo-2-methyl-1-propene;Bulk Pharmaceuticals and Intermediates;1-Bromo-2-methyl-2-propene;1-propene,3-bromo-2-methyl-;2-(bromomethyl)propene;2-Methyl-2-propenylbromide;2-Methyl-3-bromo-1-propene;2-methylallylbromide;3-Bromo-2-methyl-1-propylene;5-methoxy-3,4-dihydronaphthalen-1(2H)-one;3-bromo-2-methylprop-1-ene; |
| Molecular Structure: |
 |
if you are sourcing Bulk Pharmaceuticals and Intermediates from Japan ,just feel free to inquire